EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19N |
| Net Charge | 0 |
| Average Mass | 249.357 |
| Monoisotopic Mass | 249.15175 |
| SMILES | CNCC12CCC(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C18H19N/c1-19-12-18-11-10-13(14-6-2-4-8-16(14)18)15-7-3-5-9-17(15)18/h2-9,13,19H,10-12H2,1H3 |
| InChIKey | GNRXCIONJWKSEA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzoctamine (CHEBI:135017) has role anxiolytic drug (CHEBI:35474) |
| benzoctamine (CHEBI:135017) is a anthracenes (CHEBI:46955) |
| INN | Source |
|---|---|
| benzoctamina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Benzoctamine | ChEMBL |
| benzoctamine HCl | DrugCentral |
| benzoctamine hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 324 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:17243-39-9 | DrugCentral |