EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO4S2 |
| Net Charge | 0 |
| Average Mass | 249.313 |
| Monoisotopic Mass | 249.01295 |
| SMILES | O=C(O)CSCC(=O)NC1CCSC1=O |
| InChI | InChI=1S/C8H11NO4S2/c10-6(3-14-4-7(11)12)9-5-1-2-15-8(5)13/h5H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | QGFORSXNKQLDNO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erdosteine (CHEBI:135014) is a N-acyl-amino acid (CHEBI:51569) |
| INN | Source |
|---|---|
| erdosteina | WHO MedNet |
| Synonyms | Source |
|---|---|
| dithiosteine | DrugCentral |
| Erdosteine | ChEMBL |
| Mucotec | ChEMBL |
| RV-144 | ChEMBL |
| RV144 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1041 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:84611-23-4 | DrugCentral |
| Citations |
|---|