EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N2O2S |
| Net Charge | 0 |
| Average Mass | 248.307 |
| Monoisotopic Mass | 248.06195 |
| SMILES | CSc1ccc(C(=O)c2nc(=O)nc2C)cc1 |
| InChI | InChI=1S/C12H12N2O2S/c1-7-10(14-12(16)13-7)11(15)8-3-5-9(17-2)6-4-8/h3-6H,1-2H3,(H2,13,14,16) |
| InChIKey | ZJKNESGOIKRXQY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enoximone (CHEBI:135010) has role cardiovascular drug (CHEBI:35554) |
| enoximone (CHEBI:135010) is a aromatic ketone (CHEBI:76224) |
| INN | Source |
|---|---|
| enoximona | WHO MedNet |
| Synonyms | Source |
|---|---|
| Enoximone | ChEMBL |
| fenoximone | DrugCentral |
| MDL 17,043 | ChEMBL |
| MDL-17043 | ChEMBL |
| Brand Name | Source |
|---|---|
| Perfan | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1014 | DrugCentral |
| HMDB0015599 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:77671-31-9 | DrugCentral |
| Citations |
|---|