EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO2 |
| Net Charge | 0 |
| Average Mass | 247.338 |
| Monoisotopic Mass | 247.15723 |
| SMILES | C[C@@H]1C[C@@H](OC(=O)c2cccnc2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H21NO2/c1-11-7-13(9-15(2,3)8-11)18-14(17)12-5-4-6-16-10-12/h4-6,10-11,13H,7-9H2,1-3H3/t11-,13-/m1/s1 |
| InChIKey | GQSGZTBDVNUIQS-DGCLKSJQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciclonicate (CHEBI:135007) has role cardiovascular drug (CHEBI:35554) |
| ciclonicate (CHEBI:135007) is a aromatic carboxylic acid (CHEBI:33859) |
| ciclonicate (CHEBI:135007) is a pyridines (CHEBI:26421) |
| INN | Source |
|---|---|
| ciclonicato | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ciclonicate | ChEMBL |
| cyclonicate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3908 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:53449-58-4 | DrugCentral |