EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O3 |
| Net Charge | 0 |
| Average Mass | 246.306 |
| Monoisotopic Mass | 246.12559 |
| SMILES | CC1=C(CO)C2=C(C)C3(CC3)[C@@](C)(O)C(=O)C2=C1 |
| InChI | InChI=1S/C15H18O3/c1-8-6-10-12(11(8)7-16)9(2)15(4-5-15)14(3,18)13(10)17/h6,16,18H,4-5,7H2,1-3H3/t14-/m0/s1 |
| InChIKey | NICJCIQSJJKZAH-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| irofulven (CHEBI:135002) has role antineoplastic agent (CHEBI:35610) |
| irofulven (CHEBI:135002) is a cyclohexenones (CHEBI:48953) |
| INNs | Source |
|---|---|
| irofulven | WHO MedNet |
| irofulvene | WHO MedNet |
| irofulveno | WHO MedNet |
| Synonyms | Source |
|---|---|
| 6-hydroxymethylacylfulvene | DrugCentral |
| (hydroxymethyl)acylfulvene | ChEMBL |
| (-)-Irofulven | DrugCentral |
| LP-100 | ChEMBL |
| MGI 114 | ChEMBL |
| MGI-114 | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1483 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:158440-71-2 | DrugCentral |
| Citations |
|---|