EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N6O2 |
| Net Charge | 0 |
| Average Mass | 246.230 |
| Monoisotopic Mass | 246.08652 |
| SMILES | Cn1c([N+](=O)[O-])cnc1/C=C/c1ccnc(N)n1 |
| InChI | InChI=1S/C10H10N6O2/c1-15-8(13-6-9(15)16(17)18)3-2-7-4-5-12-10(11)14-7/h2-6H,1H3,(H2,11,12,14)/b3-2+ |
| InChIKey | LHIALLMPKJMSIQ-NSCUHMNNSA-N |
| Roles Classification |
|---|
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azanidazole (CHEBI:135001) has role antiamoebic agent (CHEBI:171664) |
| azanidazole (CHEBI:135001) is a C-nitro compound (CHEBI:35716) |
| azanidazole (CHEBI:135001) is a imidazoles (CHEBI:24780) |
| INN | Source |
|---|---|
| azanidazol | WHO MedNet |
| Synonyms | Source |
|---|---|
| Azanidazole | ChEMBL |
| nitromidine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 264 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:62973-76-6 | DrugCentral |
| Citations |
|---|