EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17N3O |
| Net Charge | 0 |
| Average Mass | 243.310 |
| Monoisotopic Mass | 243.13716 |
| SMILES | CN[C@@H]1CCc2nc3ccc(C(N)=O)cc3c2C1 |
| InChI | InChI=1S/C14H17N3O/c1-16-9-3-5-13-11(7-9)10-6-8(14(15)18)2-4-12(10)17-13/h2,4,6,9,16-17H,3,5,7H2,1H3,(H2,15,18)/t9-/m1/s1 |
| InChIKey | XPSQPHWEGNHMSK-SECBINFHSA-N |
| Roles Classification |
|---|
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Application: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| frovatriptan (CHEBI:134991) has role analgesic (CHEBI:35480) |
| frovatriptan (CHEBI:134991) is a carbazoles (CHEBI:48513) |
| Synonyms | Source |
|---|---|
| Allergo filmtabletten | ChEMBL |
| Frovatriptan | ChEMBL |
| frovatriptan succinate | DrugCentral |
| frovatriptan succinate hydrate | DrugCentral |
| (R)-Frovatriptan | DrugCentral |
| SB 209509 | DrugCentral |
| Brand Names | Source |
|---|---|
| Migard | ChEMBL |
| Mylatrip | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1251 | DrugCentral |
| HMDB0015133 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:158747-02-5 | DrugCentral |
| Citations |
|---|