EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17NO2 |
| Net Charge | 0 |
| Average Mass | 243.306 |
| Monoisotopic Mass | 243.12593 |
| SMILES | COc1ccc2cccc(CCNC(C)=O)c2c1 |
| InChI | InChI=1S/C15H17NO2/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13/h3-7,10H,8-9H2,1-2H3,(H,16,17) |
| InChIKey | YJYPHIXNFHFHND-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| agomelatine (CHEBI:134990) has role antidepressant (CHEBI:35469) |
| agomelatine (CHEBI:134990) has role antipsychotic agent (CHEBI:35476) |
| agomelatine (CHEBI:134990) has role anxiolytic drug (CHEBI:35474) |
| agomelatine (CHEBI:134990) is a acetamides (CHEBI:22160) |
| INN | Source |
|---|---|
| agomelatina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Agomelatine | ChEMBL |
| S-20098 | DrugCentral |
| S20098 | DrugCentral |
| thymanax | DrugCentral |
| valdoxan | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 99 | DrugCentral |
| HMDB0015636 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:138112-76-2 | DrugCentral |
| Citations |
|---|