EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13N5O4 |
| Net Charge | 0 |
| Average Mass | 243.223 |
| Monoisotopic Mass | 243.09675 |
| SMILES | N=C(N)c1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C8H13N5O4/c9-6(10)7-11-2-13(12-7)8-5(16)4(15)3(1-14)17-8/h2-5,8,14-16H,1H2,(H3,9,10)/t3-,4-,5-,8-/m1/s1 |
| InChIKey | NHKZSTHOYNWEEZ-AFCXAGJDSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taribavirin (CHEBI:134989) has role antiviral agent (CHEBI:22587) |
| taribavirin (CHEBI:134989) is a nucleobase-containing molecular entity (CHEBI:61120) |
| taribavirin (CHEBI:134989) is a organic molecular entity (CHEBI:50860) |
| INNs | Source |
|---|---|
| taribavirin | WHO MedNet |
| taribavirina | WHO MedNet |
| taribavirine | WHO MedNet |
| Synonyms | Source |
|---|---|
| ribamidine | DrugCentral |
| taribavirin HCl | DrugCentral |
| taribavirin hydrochloride | DrugCentral |
| viramidine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3582 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:119567-79-2 | DrugCentral |
| Citations |
|---|