EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15ClN2O2 |
| Net Charge | 0 |
| Average Mass | 242.706 |
| Monoisotopic Mass | 242.08221 |
| SMILES | CC(C)NNC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H15ClN2O2/c1-8(2)13-14-11(15)7-16-10-5-3-9(12)4-6-10/h3-6,8,13H,7H2,1-2H3,(H,14,15) |
| InChIKey | GGECDTUJZOXAAR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iproclozide (CHEBI:134988) has role antidepressant (CHEBI:35469) |
| iproclozide (CHEBI:134988) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| iproclozida | WHO MedNet |
| Synonyms | Source |
|---|---|
| iproclozid | DrugCentral |
| Iproclozide | ChEMBL |
| PC-603 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1479 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:3544-35-2 | DrugCentral |
| Citations |
|---|