EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15NO2 |
| Net Charge | 0 |
| Average Mass | 241.290 |
| Monoisotopic Mass | 241.11028 |
| SMILES | O=C(O)c1ccccc1NCCc1ccccc1 |
| InChI | InChI=1S/C15H15NO2/c17-15(18)13-8-4-5-9-14(13)16-11-10-12-6-2-1-3-7-12/h1-9,16H,10-11H2,(H,17,18) |
| InChIKey | HLNLBEFKHHCAMV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enfenamic acid (CHEBI:134983) is a aminobenzoic acid (CHEBI:22495) |
| Synonym | Source |
|---|---|
| tromaril | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3176 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:23049-93-6 | DrugCentral |