EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N2O |
| Net Charge | 0 |
| Average Mass | 240.306 |
| Monoisotopic Mass | 240.12626 |
| SMILES | CC(NNC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16N2O/c1-12(13-8-4-2-5-9-13)16-17-15(18)14-10-6-3-7-11-14/h2-12,16H,1H3,(H,17,18) |
| InChIKey | BEWNZPMDJIGBED-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benmoxin (CHEBI:134978) is a benzoic acids (CHEBI:22723) |
| INNs | Source |
|---|---|
| benmoxin | WHO MedNet |
| benmoxina | WHO MedNet |
| Synonyms | Source |
|---|---|
| benmoxine | DrugCentral |
| mebamoxine | DrugCentral |
| nerusil | DrugCentral |
| neuralex | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3681 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:7654-03-7 | DrugCentral |