EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8BrNO |
| Net Charge | 0 |
| Average Mass | 238.084 |
| Monoisotopic Mass | 236.97893 |
| SMILES | Cc1cc(Br)c(O)c2ncccc12 |
| InChI | InChI=1S/C10H8BrNO/c1-6-5-8(11)10(13)9-7(6)3-2-4-12-9/h2-5,13H,1H3 |
| InChIKey | JMOVFFLYGIQXMM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tilbroquinol (CHEBI:134965) has role antiamoebic agent (CHEBI:171664) |
| tilbroquinol (CHEBI:134965) is a organic molecular entity (CHEBI:50860) |
| tilbroquinol (CHEBI:134965) is a organohalogen compound (CHEBI:17792) |
| tilbroquinol (CHEBI:134965) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| 5-Methyl-7-bromo-8-hydroxyquinoline | DrugCentral |
| Tilbroquinol | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2662 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:7175-09-9 | DrugCentral |
| Citations |
|---|