EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4F10 |
| Net Charge | 0 |
| Average Mass | 238.024 |
| Monoisotopic Mass | 237.98403 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4F10/c5-1(6,3(9,10)11)2(7,8)4(12,13)14 |
| InChIKey | KAVGMUDTWQVPDF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perflubutane (CHEBI:134964) has role antihypertensive agent (CHEBI:35674) |
| perflubutane (CHEBI:134964) has role antineoplastic agent (CHEBI:35610) |
| perflubutane (CHEBI:134964) has role ultrasound contrast agent (CHEBI:37337) |
| perflubutane (CHEBI:134964) is a fluoroalkane (CHEBI:24067) |
| perflubutane (CHEBI:134964) is a fluorocarbon (CHEBI:38824) |
| perflubutane (CHEBI:134964) is a gas molecular entity (CHEBI:138675) |
| IUPAC Name |
|---|
| decafluorobutane |
| INNs | Source |
|---|---|
| perflubutane | WHO MedNet |
| perflubutane | WHO MedNet |
| perflubutano | WHO MedNet |
| perflubutanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| AI-700 | ChEMBL |
| Decafluoro-butane | DrugCentral |
| perfluorobutane | DrugCentral |
| perfluoro-n-butane | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Sonazoid | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 3999 | DrugCentral |
| D05440 | KEGG DRUG |
| Perfluorobutane | Wikipedia |
| Citations |
|---|