EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O |
| Net Charge | 0 |
| Average Mass | 232.327 |
| Monoisotopic Mass | 232.15756 |
| SMILES | Cc1ccc(C(C)C)c(OCC2=NCCN2)c1 |
| InChI | InChI=1S/C14H20N2O/c1-10(2)12-5-4-11(3)8-13(12)17-9-14-15-6-7-16-14/h4-5,8,10H,6-7,9H2,1-3H3,(H,15,16) |
| InChIKey | QRORCRWSRPKEHR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tymazoline (CHEBI:134947) has role nasal decongestant (CHEBI:77715) |
| tymazoline (CHEBI:134947) is a monoterpenoid (CHEBI:25409) |
| Synonyms | Source |
|---|---|
| pernazene | DrugCentral |
| Tymazoline | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3445 | DrugCentral |
| HMDB0015693 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:24243-97-8 | DrugCentral |