EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NO |
| Net Charge | 0 |
| Average Mass | 229.323 |
| Monoisotopic Mass | 229.14666 |
| SMILES | CC(Cc1ccccc1)N(C)Cc1ccco1 |
| InChI | InChI=1S/C15H19NO/c1-13(11-14-7-4-3-5-8-14)16(2)12-15-9-6-10-17-15/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | DLGIIZAHQPTVCJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| furfenorex (CHEBI:134942) is a amphetamines (CHEBI:35338) |
| INN | Source |
|---|---|
| furfenorex | WHO MedNet |
| Synonyms | Source |
|---|---|
| D-furfenorex | ChEMBL |
| D-furfurylmethylamphetamine | ChEMBL |
| DL-Furfenorex | DrugCentral |
| furfurylmethylamphetamine | DrugCentral |
| Furfurylmethylamphetamine d-form | ChEMBL |
| SD 27115 FREE BASE | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3752 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:13445-60-8 | DrugCentral |