EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2O2 |
| Net Charge | 0 |
| Average Mass | 228.251 |
| Monoisotopic Mass | 228.08988 |
| SMILES | O=C(O)/C=C/c1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C13H12N2O2/c16-13(17)6-5-11-1-3-12(4-2-11)9-15-8-7-14-10-15/h1-8,10H,9H2,(H,16,17)/b6-5+ |
| InChIKey | SHZKQBHERIJWAO-AATRIKPKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ozagrel (CHEBI:134938) has role ophthalmology drug (CHEBI:66981) |
| ozagrel (CHEBI:134938) is a cinnamic acids (CHEBI:23252) |
| INN | Source |
|---|---|
| ozagrel | WHO MedNet |
| Synonyms | Source |
|---|---|
| domenan | DrugCentral |
| KCT-0809 | ChEMBL |
| OKY-046 | DrugCentral |
| ozagrel HCl | DrugCentral |
| ozagrel hydrochloride | DrugCentral |
| ozagrel hydrochloride hydrate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2043 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:82571-53-7 | DrugCentral |
| Citations |
|---|