EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17NO4 |
| Net Charge | 0 |
| Average Mass | 227.260 |
| Monoisotopic Mass | 227.11576 |
| SMILES | CNCC(O)c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C11H17NO4/c1-12-6-8(13)7-4-9(15-2)11(14)10(5-7)16-3/h4-5,8,12-14H,6H2,1-3H3 |
| InChIKey | ZKGDBJAHIIXDDW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimetofrine (CHEBI:134932) has role cardiovascular drug (CHEBI:35554) |
| dimetofrine (CHEBI:134932) is a methoxybenzenes (CHEBI:51683) |
| dimetofrine (CHEBI:134932) is a phenols (CHEBI:33853) |
| INN | Source |
|---|---|
| dimetofrina | WHO MedNet |
| Synonyms | Source |
|---|---|
| anassicol | DrugCentral |
| dimethophrine | DrugCentral |
| Dimetofrine | ChEMBL |
| dimetrophine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 909 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:22950-29-4 | DrugCentral |