EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N4O3 |
| Net Charge | 0 |
| Average Mass | 226.236 |
| Monoisotopic Mass | 226.10659 |
| SMILES | O=[N+]([O-])c1cncn1CCN1CCOCC1 |
| InChI | InChI=1S/C9H14N4O3/c14-13(15)9-7-10-8-12(9)2-1-11-3-5-16-6-4-11/h7-8H,1-6H2 |
| InChIKey | MDJFHRLTPRPZLY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nimorazole (CHEBI:134929) has role antiamoebic agent (CHEBI:171664) |
| nimorazole (CHEBI:134929) has role antineoplastic agent (CHEBI:35610) |
| nimorazole (CHEBI:134929) is a C-nitro compound (CHEBI:35716) |
| nimorazole (CHEBI:134929) is a imidazoles (CHEBI:24780) |
| Synonyms | Source |
|---|---|
| K-1900 | ChEMBL |
| naxofem | DrugCentral |
| naxogin | DrugCentral |
| nimorazol | DrugCentral |
| Nimorazole | ChEMBL |
| nitrimidazine | DrugCentral |
| Brand Name | Source |
|---|---|
| Naxogin 500 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1938 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:6506-37-2 | DrugCentral |
| Citations |
|---|