EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO4 |
| Net Charge | 0 |
| Average Mass | 223.228 |
| Monoisotopic Mass | 223.08446 |
| SMILES | COc1ccccc1OCC1CNC(=O)O1 |
| InChI | InChI=1S/C11H13NO4/c1-14-9-4-2-3-5-10(9)15-7-8-6-12-11(13)16-8/h2-5,8H,6-7H2,1H3,(H,12,13) |
| InChIKey | ZMNSRFNUONFLSP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mephenoxalone (CHEBI:134916) has role anxiolytic drug (CHEBI:35474) |
| mephenoxalone (CHEBI:134916) is a methoxybenzenes (CHEBI:51683) |
| mephenoxalone (CHEBI:134916) is a organic molecular entity (CHEBI:50860) |
| mephenoxalone (CHEBI:134916) is a racemate (CHEBI:60911) |
| INN | Source |
|---|---|
| mefenoxalona | WHO MedNet |
| Synonyms | Source |
|---|---|
| AHR-233 | ChEMBL |
| dorsiflex | DrugCentral |
| lenetranat | DrugCentral |
| Mefenoxalone | ChEMBL |
| Mephenoxalone | ChEMBL |
| methoxadone | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1693 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:70-07-5 | DrugCentral |