EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O2 |
| Net Charge | 0 |
| Average Mass | 222.288 |
| Monoisotopic Mass | 222.13683 |
| SMILES | CCN(CC)CCOC(=O)c1cccnc1 |
| InChI | InChI=1S/C12H18N2O2/c1-3-14(4-2)8-9-16-12(15)11-6-5-7-13-10-11/h5-7,10H,3-4,8-9H2,1-2H3 |
| InChIKey | JVWOCHRRAWHKLT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicametate (CHEBI:134915) is a aromatic carboxylic acid (CHEBI:33859) |
| nicametate (CHEBI:134915) is a pyridines (CHEBI:26421) |
| Synonym | Source |
|---|---|
| beta-Diethylaminoethyl nicotinate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3793 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:3099-52-3 | DrugCentral |