EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N4O2 |
| Net Charge | 0 |
| Average Mass | 222.248 |
| Monoisotopic Mass | 222.11168 |
| SMILES | O=C(NCN1CCOCC1)c1cnccn1 |
| InChI | InChI=1S/C10H14N4O2/c15-10(9-7-11-1-2-12-9)13-8-14-3-5-16-6-4-14/h1-2,7H,3-6,8H2,(H,13,15) |
| InChIKey | GVTLAVKAVSKBKK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| morinamide (CHEBI:134914) has role antitubercular agent (CHEBI:33231) |
| morinamide (CHEBI:134914) is a morpholines (CHEBI:38785) |
| morinamide (CHEBI:134914) is a pyrazines (CHEBI:38314) |
| morinamide (CHEBI:134914) is a secondary carboxamide (CHEBI:140325) |
| INN | Source |
|---|---|
| morinamida | WHO MedNet |
| Synonyms | Source |
|---|---|
| diazolina | DrugCentral |
| morfgazinamide | DrugCentral |
| morinamid | DrugCentral |
| Morinamide | ChEMBL |
| Morinamide hcl | ChEMBL |
| Morinamide hydrochloride | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1843 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:952-54-5 | DrugCentral |
| Citations |
|---|