EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O4 |
| Net Charge | 0 |
| Average Mass | 222.240 |
| Monoisotopic Mass | 222.08921 |
| SMILES | COc1ccc(/C(C)=C/C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C12H14O4/c1-8(6-12(13)14)10-5-4-9(15-2)7-11(10)16-3/h4-7H,1-3H3,(H,13,14)/b8-6+ |
| InChIKey | VNLOISSPTMDCIF-SOFGYWHQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimecrotic acid (CHEBI:134913) is a cinnamic acids (CHEBI:23252) |
| Synonym | Source |
|---|---|
| 2,4-Dimethoxy-beta-methylcinnamic acid | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 898 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:7706-67-4 | DrugCentral |