EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO4S |
| Net Charge | 0 |
| Average Mass | 205.235 |
| Monoisotopic Mass | 205.04088 |
| SMILES | CC(=O)N[C@@H](CSC(C)=O)C(=O)O |
| InChI | InChI=1S/C7H11NO4S/c1-4(9)8-6(7(11)12)3-13-5(2)10/h6H,3H2,1-2H3,(H,8,9)(H,11,12)/t6-/m0/s1 |
| InChIKey | HSPYGHDTVQJUDE-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dacisteine (CHEBI:134905) is a N-acyl-L-amino acid (CHEBI:21644) |
| Synonym | Source |
|---|---|
| mucothiol | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1760 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:18725-37-6 | DrugCentral |