EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O |
| Net Charge | 0 |
| Average Mass | 218.300 |
| Monoisotopic Mass | 218.14191 |
| SMILES | CC(C)c1ccccc1OCC1=NCCN1 |
| InChI | InChI=1S/C13H18N2O/c1-10(2)11-5-3-4-6-12(11)16-9-13-14-7-8-15-13/h3-6,10H,7-9H2,1-2H3,(H,14,15) |
| InChIKey | GFYSWQDCHLWRMQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenoxazoline (CHEBI:134903) has role nasal decongestant (CHEBI:77715) |
| fenoxazoline (CHEBI:134903) is a alkylbenzene (CHEBI:38976) |
| INN | Source |
|---|---|
| fenoxazolina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Fenoxazoline | ChEMBL |
| nebulicina | DrugCentral |
| phenoxazoline | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3225 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:4846-91-7 | DrugCentral |
| Citations |
|---|