EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N |
| Net Charge | 0 |
| Average Mass | 217.356 |
| Monoisotopic Mass | 217.18305 |
| SMILES | CCCC(Cc1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C15H23N/c1-2-8-15(16-11-6-7-12-16)13-14-9-4-3-5-10-14/h3-5,9-10,15H,2,6-8,11-13H2,1H3 |
| InChIKey | OJCPSBCUMRIPFL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prolintane (CHEBI:134898) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| phenylpyrrolidinopentane | DrugCentral |
| prolintan | DrugCentral |
| prolintane HCl | DrugCentral |
| prolintane hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2283 | DrugCentral |
| HMDB0041998 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:493-92-5 | DrugCentral |