EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17N3 |
| Net Charge | 0 |
| Average Mass | 215.300 |
| Monoisotopic Mass | 215.14225 |
| SMILES | c1cc2c(c(NC3=NCCN3)c1)CCCC2 |
| InChI | InChI=1S/C13H17N3/c1-2-6-11-10(4-1)5-3-7-12(11)16-13-14-8-9-15-13/h3,5,7H,1-2,4,6,8-9H2,(H2,14,15,16) |
| InChIKey | QQJLHRRUATVHED-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tramazoline (CHEBI:134893) has role nasal decongestant (CHEBI:77715) |
| tramazoline (CHEBI:134893) is a tetralins (CHEBI:36786) |
| INN | Source |
|---|---|
| tramazolina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Muconasal | ChEMBL |
| rhinol | DrugCentral |
| Tramazoline | ChEMBL |
| tramazoline HCl | DrugCentral |
| tramazoline hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3620 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:1082-57-1 | DrugCentral |
| Citations |
|---|