EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9N3O2 |
| Net Charge | 0 |
| Average Mass | 215.212 |
| Monoisotopic Mass | 215.06948 |
| SMILES | NC(=O)N/N=C1\C=Cc2ccccc2C1=O |
| InChI | InChI=1S/C11H9N3O2/c12-11(16)14-13-9-6-5-7-3-1-2-4-8(7)10(9)15/h1-6H,(H3,12,14,16)/b13-9+ |
| InChIKey | TZGBBMBARSFJBG-UKTHLTGXSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naftazone (CHEBI:134890) has role cardiovascular drug (CHEBI:35554) |
| naftazone (CHEBI:134890) is a naphthalenes (CHEBI:25477) |
| INN | Source |
|---|---|
| naftazona | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,2-naphthoquinone 2-semicarbazone | ChEMBL |
| Haemostop injection | ChEMBL |
| Karbinon | ChEMBL |
| Mediaven | ChEMBL |
| naftazon | DrugCentral |
| Naftazone | ChEMBL |
| Brand Name | Source |
|---|---|
| Mediavan | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1871 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:15687-37-3 | DrugCentral |