EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18ClN |
| Net Charge | 0 |
| Average Mass | 211.736 |
| Monoisotopic Mass | 211.11278 |
| SMILES | CC(Cc1ccccc1)NCCCCl |
| InChI | InChI=1S/C12H18ClN/c1-11(14-9-5-8-13)10-12-6-3-2-4-7-12/h2-4,6-7,11,14H,5,8-10H2,1H3 |
| InChIKey | XXVROGAVTTXONC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mefenorex (CHEBI:134883) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| chloropropylamphetamine | DrugCentral |
| mefenorex HCl | DrugCentral |
| mefenorex hydrochloride | DrugCentral |
| rondimen | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1664 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:17243-57-1 | DrugCentral |