EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO4 |
| Net Charge | 0 |
| Average Mass | 211.217 |
| Monoisotopic Mass | 211.08446 |
| SMILES | COC(=O)[C@@H](N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H13NO4/c1-15-10(14)7(11)4-6-2-3-8(12)9(13)5-6/h2-3,5,7,12-13H,4,11H2,1H3/t7-/m0/s1 |
| InChIKey | XBBDACCLCFWBSI-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| melevodopa (CHEBI:134880) has role antiparkinson drug (CHEBI:48407) |
| melevodopa (CHEBI:134880) is a tyrosine derivative (CHEBI:62761) |
| Synonyms | Source |
|---|---|
| CHF-1301 | ChEMBL |
| L-dopa methyl ester | DrugCentral |
| levodopa methyl ester | DrugCentral |
| levomet | DrugCentral |
| Melevodopa | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1673 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:7101-51-1 | DrugCentral |
| Citations |
|---|