EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12ClN3 |
| Net Charge | 0 |
| Average Mass | 209.680 |
| Monoisotopic Mass | 209.07198 |
| SMILES | Cc1ccc(NC2=NCCN2)c(Cl)c1 |
| InChI | InChI=1S/C10H12ClN3/c1-7-2-3-9(8(11)6-7)14-10-12-4-5-13-10/h2-3,6H,4-5H2,1H3,(H2,12,13,14) |
| InChIKey | KWBTZIFLQYYPTH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolonidine (CHEBI:134879) has role antihypertensive agent (CHEBI:35674) |
| tolonidine (CHEBI:134879) is a substituted aniline (CHEBI:48975) |
| INN | Source |
|---|---|
| tolonidina | WHO MedNet |
| Synonyms | Source |
|---|---|
| ST 375 | ChEMBL |
| ST-375 | ChEMBL |
| Tolonidine | ChEMBL |
| tolonidine monohydrochloride | DrugCentral |
| tolonidine mononitrate | DrugCentral |
| tolonidine nitrate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2700 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:4201-22-3 | DrugCentral |
| Citations |
|---|