EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N3O2 |
| Net Charge | 0 |
| Average Mass | 207.233 |
| Monoisotopic Mass | 207.10078 |
| SMILES | N=C(N)NCC1COc2ccccc2O1 |
| InChI | InChI=1S/C10H13N3O2/c11-10(12)13-5-7-6-14-8-3-1-2-4-9(8)15-7/h1-4,7H,5-6H2,(H4,11,12,13) |
| InChIKey | HIUVKVDQFXDZHU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanoxan (CHEBI:134871) has role antihypertensive agent (CHEBI:35674) |
| guanoxan (CHEBI:134871) is a benzodioxine (CHEBI:64096) |
| INN | Source |
|---|---|
| guanoxano | WHO MedNet |
| Synonyms | Source |
|---|---|
| Guanoxan | ChEMBL |
| guanoxane | DrugCentral |
| guanoxan sulfate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1346 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:2165-19-7 | DrugCentral |
| Citations |
|---|