EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO3 |
| Net Charge | 0 |
| Average Mass | 207.229 |
| Monoisotopic Mass | 207.08954 |
| SMILES | O=C(OCC1CCCO1)c1cccnc1 |
| InChI | InChI=1S/C11H13NO3/c13-11(9-3-1-5-12-7-9)15-8-10-4-2-6-14-10/h1,3,5,7,10H,2,4,6,8H2 |
| InChIKey | RQAITHJHUFFEIV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thurfyl nicotinate (CHEBI:134869) is a aromatic carboxylic acid (CHEBI:33859) |
| thurfyl nicotinate (CHEBI:134869) is a pyridines (CHEBI:26421) |
| Synonyms | Source |
|---|---|
| nicotafuryl | DrugCentral |
| nicotinic acid tetrahydrofurfuryl ester | DrugCentral |
| tetrahydrofurfuryl nicotinate | DrugCentral |
| thurfyl nicotinat | DrugCentral |
| trafuril | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3602 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:70-19-9 | DrugCentral |