EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N3 |
| Net Charge | 0 |
| Average Mass | 201.273 |
| Monoisotopic Mass | 201.12660 |
| SMILES | c1cc2c(c(NC3=NCCN3)c1)CCC2 |
| InChI | InChI=1S/C12H15N3/c1-3-9-4-2-6-11(10(9)5-1)15-12-13-7-8-14-12/h2,4,6H,1,3,5,7-8H2,(H2,13,14,15) |
| InChIKey | KUCWWEPJRBANHL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indanazoline (CHEBI:134863) has role nasal decongestant (CHEBI:77715) |
| indanazoline (CHEBI:134863) is a indanes (CHEBI:46940) |
| INN | Source |
|---|---|
| indanazolina | WHO MedNet |
| Synonyms | Source |
|---|---|
| farial | DrugCentral |
| Indanazoline | ChEMBL |
| indanazoline HCl | DrugCentral |
| indanazoline hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3298 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:40507-78-6 | DrugCentral |