EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO4 |
| Net Charge | 0 |
| Average Mass | 195.174 |
| Monoisotopic Mass | 195.05316 |
| SMILES | NC(=O)c1ccccc1OCC(=O)O |
| InChI | InChI=1S/C9H9NO4/c10-9(13)6-3-1-2-4-7(6)14-5-8(11)12/h1-4H,5H2,(H2,10,13)(H,11,12) |
| InChIKey | RLISWLLILOTWGG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salamidacetic acid (CHEBI:134850) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| o-carboxyamidophenoxyacetic acid | DrugCentral |
| salicylamide o-acetic acid | DrugCentral |
| sodium salamidacetate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3538 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:25395-22-6 | DrugCentral |