EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N6 |
| Net Charge | 0 |
| Average Mass | 190.210 |
| Monoisotopic Mass | 190.09669 |
| SMILES | N/N=c1\nn/c(=N\N)c2ccccc12 |
| InChI | InChI=1S/C8H10N6/c9-11-7-5-3-1-2-4-6(5)8(12-10)14-13-7/h1-4H,9-10H2,(H,11,13)(H,12,14) |
| InChIKey | VQKLRVZQQYVIJW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydralazine (CHEBI:134841) has role antihypertensive agent (CHEBI:35674) |
| dihydralazine (CHEBI:134841) is a phthalazines (CHEBI:38768) |
| INN | Source |
|---|---|
| dihidralazina | WHO MedNet |
| Synonyms | Source |
|---|---|
| dihydralazin | DrugCentral |
| Dihydralazine | ChEMBL |
| dihydralazine sulfate | DrugCentral |
| dihydrallazine | DrugCentral |
| dihydrazinophthalazine | DrugCentral |
| hypopresol | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 884 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:484-23-1 | DrugCentral |
| Citations |
|---|