EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:134837 - fenproporex
| Formula | C12H16N2 |
| Net Charge | 0 |
| Average Mass | 188.274 |
| Monoisotopic Mass | 188.13135 |
| SMILES | CC(Cc1ccccc1)NCCC#N |
| InChI | InChI=1S/C12H16N2/c1-11(14-9-5-8-13)10-12-6-3-2-4-7-12/h2-4,6-7,11,14H,5,9-10H2,1H3 |
| InChIKey | IQUFSXIQAFPIMR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenproporex (CHEBI:134837) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| cyanoethylamphetamine | DrugCentral |
| desobesi | DrugCentral |
| fenproporex chlorhydrate | DrugCentral |
| fenproporex hydrochloride | DrugCentral |
| ferrproporex | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1161 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:16397-28-7 | DrugCentral |