EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N2O2 |
| Net Charge | 0 |
| Average Mass | 186.255 |
| Monoisotopic Mass | 186.13683 |
| SMILES | CCC(C)C(CC)C(=O)NC(N)=O |
| InChI | InChI=1S/C9H18N2O2/c1-4-6(3)7(5-2)8(12)11-9(10)13/h6-7H,4-5H2,1-3H3,(H3,10,11,12,13) |
| InChIKey | HLSLSXBFTXUKCY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capuride (CHEBI:134831) has role sedative (CHEBI:35717) |
| capuride (CHEBI:134831) is a N-acylurea (CHEBI:74266) |
| IUPAC Name |
|---|
| N-carbamoyl-2-ethyl-3-methylpentanamide |
| INNs | Source |
|---|---|
| capurida | ChemIDplus |
| capuride | WHO MedNet |
| capuride | ChemIDplus |
| capuridum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(2-Ethyl-3-methylpentanoyl)urea | ChemIDplus |
| (2-Ethyl-3-methylvaleryl)urea | ChemIDplus |
| (Ethyl-sec-butylacetyl)urea | ChemIDplus |
| MCN-X-94 | ChEMBL |
| NSC-27178 | ChEMBL |
| NSC-27690 | ChEMBL |
| Citations |
|---|