EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H20N4 |
| Net Charge | 0 |
| Average Mass | 184.287 |
| Monoisotopic Mass | 184.16880 |
| SMILES | N=C(N)NCC1CCCCCCN1 |
| InChI | InChI=1S/C9H20N4/c10-9(11)13-7-8-5-3-1-2-4-6-12-8/h8,12H,1-7H2,(H4,10,11,13) |
| InChIKey | ZCVAIGPGEINFCX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanazodine (CHEBI:134828) has role antihypertensive agent (CHEBI:35674) |
| guanazodine (CHEBI:134828) is a guanidines (CHEBI:24436) |
| INN | Source |
|---|---|
| guanazodina | WHO MedNet |
| Synonym | Source |
|---|---|
| Guanazodine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3455 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:32059-15-7 | DrugCentral |