EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO3 |
| Net Charge | 0 |
| Average Mass | 173.212 |
| Monoisotopic Mass | 173.10519 |
| SMILES | CC(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C8H15NO3/c1-7(10)9-6-4-2-3-5-8(11)12/h2-6H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | WDSCBUNMANHPFH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acexamic acid (CHEBI:134808) is a medium-chain fatty acid (CHEBI:59554) |
| Synonyms | Source |
|---|---|
| 6-Acetamidocaproic acid | DrugCentral |
| 6-Acetamidohexanoic acid | DrugCentral |
| 6-(Acetylamino)hexanoic acid | DrugCentral |
| acemin | DrugCentral |
| acetaminocaproic acid | DrugCentral |
| calcium acexamate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3000 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:57-08-9 | DrugCentral |