EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO |
| Net Charge | 0 |
| Average Mass | 165.236 |
| Monoisotopic Mass | 165.11536 |
| SMILES | CNC(C)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C10H15NO/c1-8(11-2)7-9-3-5-10(12)6-4-9/h3-6,8,11-12H,7H2,1-2H3 |
| InChIKey | SBUQZKJEOOQSBV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pholedrine (CHEBI:134798) is a amphetamines (CHEBI:35338) |
| INNs | Source |
|---|---|
| foledrina | WHO MedNet |
| pholedrine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-hydroxymethamphetamine | ChEMBL |
| Isodrine | ChEMBL |
| Isodrin (sympathomimetic) | ChEMBL |
| KNOLL-H75 | ChEMBL |
| Oh-ma | ChEMBL |
| P-(2-methylaminopropyl)phenol | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3463 | DrugCentral |
| HMDB0060767 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:370-14-9 | DrugCentral |