EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17N |
| Net Charge | 0 |
| Average Mass | 163.264 |
| Monoisotopic Mass | 163.13610 |
| SMILES | CCNC(C)Cc1ccccc1 |
| InChI | InChI=1S/C11H17N/c1-3-12-10(2)9-11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3 |
| InChIKey | YAGBSNMZQKEFCO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etilamfetamine (CHEBI:134796) has role anti-obesity agent (CHEBI:74518) |
| etilamfetamine (CHEBI:134796) is a amphetamines (CHEBI:35338) |
| INN | Source |
|---|---|
| etilanfetamina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-Ethylamino-1-phenylpropane | DrugCentral |
| apetinil | DrugCentral |
| ethylamphetamine | DrugCentral |
| (+/-)-Ethylamphetamine | DrugCentral |
| ethylamphetamine HCl | DrugCentral |
| ethylamphetamine hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1100 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:457-87-4 | DrugCentral |