EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO2 |
| Net Charge | 0 |
| Average Mass | 153.181 |
| Monoisotopic Mass | 153.07898 |
| SMILES | NCC(O)c1cccc(O)c1 |
| InChI | InChI=1S/C8H11NO2/c9-5-8(11)6-2-1-3-7(10)4-6/h1-4,8,10-11H,5,9H2 |
| InChIKey | LRCXRAABFLIVAI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norfenefrine (CHEBI:134779) has role cardiovascular drug (CHEBI:35554) |
| norfenefrine (CHEBI:134779) is a phenols (CHEBI:33853) |
| INN | Source |
|---|---|
| norfenefrina | WHO MedNet |
| Synonyms | Source |
|---|---|
| DL-Norphenylephrine | DrugCentral |
| metacardiol | DrugCentral |
| metaoctopamine | DrugCentral |
| Norfenefrine | ChEMBL |
| norfenefrine HCl | DrugCentral |
| norfenefrine hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1966 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:536-21-0 | DrugCentral |
| Citations |
|---|