EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H9NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5,9H2,(H,10,11) |
| InChIKey | QCTBMLYLENLHLA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminomethylbenzoic acid (CHEBI:134774) is a benzoic acids (CHEBI:22723) |
| Synonyms | Source |
|---|---|
| 4-aminomethyl-benzoic acid | DrugCentral |
| 4-aminomethylbenzoic acid | DrugCentral |
| 4-(aminomethyl)benzoic acid | ChEMBL |
| Aminomethylbenzoic acid | ChEMBL |
| benzylamine-4-carboxylic acid | DrugCentral |
| gumbix | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 22 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:56-91-7 | DrugCentral |
| Citations |
|---|