EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2 |
| Net Charge | 0 |
| Average Mass | 150.225 |
| Monoisotopic Mass | 150.11570 |
| SMILES | CC(Cc1ccccc1)NN |
| InChI | InChI=1S/C9H14N2/c1-8(11-10)7-9-5-3-2-4-6-9/h2-6,8,11H,7,10H2,1H3 |
| InChIKey | VXTWEDPZMSVFEF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pheniprazine (CHEBI:134773) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| 1-phenyl-2-hydrazinopropane | DrugCentral |
| beta-phenylisopropylhydrazine | DrugCentral |
| pheniprazine HCl | DrugCentral |
| pheniprazine hydrochloride | DrugCentral |
| phenizine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2131 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:55-52-7 | DrugCentral |