EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19N |
| Net Charge | 0 |
| Average Mass | 141.258 |
| Monoisotopic Mass | 141.15175 |
| SMILES | CNC(C)CC1CCCC1 |
| InChI | InChI=1S/C9H19N/c1-8(10-2)7-9-5-3-4-6-9/h8-10H,3-7H2,1-2H3 |
| InChIKey | HFXKQSZZZPGLKQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclopentamine (CHEBI:134766) has role nasal decongestant (CHEBI:77715) |
| cyclopentamine (CHEBI:134766) is a secondary amino compound (CHEBI:50995) |
| INN | Source |
|---|---|
| ciclopentamina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Clopane | ChEMBL |
| cyclonarol | DrugCentral |
| cyclopentadrine | DrugCentral |
| cyclopentamin | DrugCentral |
| Cyclopentamine | ChEMBL |
| Cyklosal | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 755 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:102-45-4 | DrugCentral |
| Citations |
|---|