EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5NO3 |
| Net Charge | 0 |
| Average Mass | 139.110 |
| Monoisotopic Mass | 139.02694 |
| SMILES | O=C(O)c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C6H5NO3/c8-6(9)5-2-1-3-7(10)4-5/h1-4H,(H,8,9) |
| InChIKey | FJCFFCXMEXZEIM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxiniacic acid (CHEBI:134763) is a aromatic carboxylic acid (CHEBI:33859) |
| oxiniacic acid (CHEBI:134763) is a pyridines (CHEBI:26421) |
| INNs | Source |
|---|---|
| acide oxiniacique | WHO MedNet |
| acido oxiniacico | WHO MedNet |
| oxiniacic acid | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-Carboxypyridine 1-oxide | DrugCentral |
| N-Hydroxynicotinic acid | DrugCentral |
| nicotinic acid oxide | DrugCentral |
| NSC-93890 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3410 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:2398-81-4 | DrugCentral |
| Citations |
|---|