EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO2 |
| Net Charge | 0 |
| Average Mass | 137.138 |
| Monoisotopic Mass | 137.04768 |
| SMILES | COC(=O)c1cccnc1 |
| InChI | InChI=1S/C7H7NO2/c1-10-7(9)6-3-2-4-8-5-6/h2-5H,1H3 |
| InChIKey | YNBADRVTZLEFNH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl nicotinate (CHEBI:134761) is a aromatic carboxylic acid (CHEBI:33859) |
| methyl nicotinate (CHEBI:134761) is a pyridines (CHEBI:26421) |
| Synonym | Source |
|---|---|
| methyl 3-pyridinecarboxylate | DrugCentral |
| UniProt Name | Source |
|---|---|
| methyl nicotinate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 3355 | DrugCentral |
| HMDB0029806 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:93-60-7 | DrugCentral |