EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H19N |
| Net Charge | 0 |
| Average Mass | 129.247 |
| Monoisotopic Mass | 129.15175 |
| SMILES | CC(C)CCCC(C)N |
| InChI | InChI=1S/C8H19N/c1-7(2)5-4-6-8(3)9/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | QNIVIMYXGGFTAK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octodrine (CHEBI:134758) is a alkylamine (CHEBI:13759) |
| INNs | Source |
|---|---|
| octodrina | WHO MedNet |
| octodrine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,5-dmha | ChEMBL |
| amidrine | DrugCentral |
| isoctaminum | DrugCentral |
| NSC-759813 | ChEMBL |
| octodrin | DrugCentral |
| SK&F 51 | ChEMBL |
| Brand Name | Source |
|---|---|
| Octodrine component of oxyelite pro dmha | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1978 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:543-82-8 | DrugCentral |