EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H17N |
| Net Charge | 0 |
| Average Mass | 115.220 |
| Monoisotopic Mass | 115.13610 |
| SMILES | CCCCCC(C)N |
| InChI | InChI=1S/C7H17N/c1-3-4-5-6-7(2)8/h7H,3-6,8H2,1-2H3 |
| InChIKey | VSRBKQFNFZQRBM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tuaminoheptane (CHEBI:134753) has role nasal decongestant (CHEBI:77715) |
| tuaminoheptane (CHEBI:134753) is a alkylamine (CHEBI:13759) |
| INN | Source |
|---|---|
| tuaminoheptano | WHO MedNet |
| Synonyms | Source |
|---|---|
| heptamine | DrugCentral |
| heptin | DrugCentral |
| NSC-1091 | ChEMBL |
| rineptil | DrugCentral |
| rineptyl | DrugCentral |
| tuamine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3637 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:123-82-0 | DrugCentral |
| Citations |
|---|